C12H11N3O3 — CID 82201489
1-[1-(1,3-benzodioxol-5-yl)-5-methyltriazol-4-yl]ethanone (PubChem CID 82201489) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-5-methyltriazol-4-yl]ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-5-methyltriazol-4-yl]ethanone |
|---|---|
| PubChem CID | 82201489 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-5-methyltriazol-4-yl]ethanone |
| SMILES | CC(=O)c1nnn(-c2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C12H11N3O3/c1-7-12(8(2)16)13-14-15(7)9-3-4-10-11(5-9)18-6-17-10/h3-5H,6H2,1-2H3 |
| InChIKey | CNDDHBMUBKGDHR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |