C16H17N3O3 — CID 82196917
1-(1,3-benzodioxol-5-yl)-5-cyclohexyltriazole-4-carbaldehyde (PubChem CID 82196917) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-cyclohexyltriazole-4-carbaldehyde.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-cyclohexyltriazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82196917 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-cyclohexyltriazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(-c2ccc3c(c2)OCO3)c1C1CCCCC1 |
| InChI | InChI=1S/C16H17N3O3/c20-9-13-16(11-4-2-1-3-5-11)19(18-17-13)12-6-7-14-15(8-12)22-10-21-14/h6-9,11H,1-5,10H2 |
| InChIKey | GJAIXQUGORHHQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|