C12H13N3O3 — CID 56686707
[1-(1,3-benzodioxol-5-yl)-5-ethyltriazol-4-yl]methanol (PubChem CID 56686707) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-5-ethyltriazol-4-yl]methanol.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-5-ethyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 56686707 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-5-ethyltriazol-4-yl]methanol |
| SMILES | CCc1c(CO)nnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13N3O3/c1-2-10-9(6-16)13-14-15(10)8-3-4-11-12(5-8)18-7-17-11/h3-5,16H,2,6-7H2,1H3 |
| InChIKey | COKALKDZOYAOJZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |