C12H10N4O2 — CID 82196895
1-(1,3-benzodioxol-5-yl)-5-ethyltriazole-4-carbonitrile (PubChem CID 82196895) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-ethyltriazole-4-carbonitrile.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-ethyltriazole-4-carbonitrile |
|---|---|
| PubChem CID | 82196895 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-ethyltriazole-4-carbonitrile |
| SMILES | CCc1c(C#N)nnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H10N4O2/c1-2-10-9(6-13)14-15-16(10)8-3-4-11-12(5-8)18-7-17-11/h3-5H,2,7H2,1H3 |
| InChIKey | GKZLFUYHZRBJMD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |