About 3-(3-aminophenyl)aniline;sulfane
3-(3-aminophenyl)aniline;sulfane (PubChem CID 175159845) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is 3-(3-aminophenyl)aniline;sulfane.
Molecular Properties
| Compound Name | 3-(3-aminophenyl)aniline;sulfane |
| PubChem CID | 175159845 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-(3-aminophenyl)aniline;sulfane |
| SMILES | Nc1cccc(-c2cccc(N)c2)c1.S |
| InChI | InChI=1S/C12H12N2.H2S/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10;/h1-8H,13-14H2;1H2 |
| InChIKey | HHNNGWDTKCGUIK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-aminophenyl)aniline;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminophenyl)aniline;sulfane?
The IUPAC name of 3-(3-aminophenyl)aniline;sulfane (CID 175159845) is 3-(3-aminophenyl)aniline;sulfane.
What is the SMILES notation for 3-(3-aminophenyl)aniline;sulfane?
The canonical SMILES for 3-(3-aminophenyl)aniline;sulfane is Nc1cccc(-c2cccc(N)c2)c1.S.
What is the InChIKey of 3-(3-aminophenyl)aniline;sulfane?
The InChIKey is HHNNGWDTKCGUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.H2S/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10;/h1-8H,13-14H2;1H2.
What are the key properties of 3-(3-aminophenyl)aniline;sulfane?
3-(3-aminophenyl)aniline;sulfane has a molecular weight of 218.33 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminophenyl)aniline;sulfane is sourced from PubChem (CID 175159845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).