About benzene-1,3-diamine;hydrate
benzene-1,3-diamine;hydrate (PubChem CID 133188498) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is benzene-1,3-diamine;hydrate.
Molecular Properties
| Compound Name | benzene-1,3-diamine;hydrate |
| PubChem CID | 133188498 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | benzene-1,3-diamine;hydrate |
| SMILES | Nc1cccc(N)c1.O |
| InChI | InChI=1S/C6H8N2.H2O/c7-5-2-1-3-6(8)4-5;/h1-4H,7-8H2;1H2 |
| InChIKey | IUGVOKNDMJRHSG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diamine;hydrate?
The IUPAC name of benzene-1,3-diamine;hydrate (CID 133188498) is benzene-1,3-diamine;hydrate.
What is the SMILES notation for benzene-1,3-diamine;hydrate?
The canonical SMILES for benzene-1,3-diamine;hydrate is Nc1cccc(N)c1.O.
What is the InChIKey of benzene-1,3-diamine;hydrate?
The InChIKey is IUGVOKNDMJRHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.H2O/c7-5-2-1-3-6(8)4-5;/h1-4H,7-8H2;1H2.
What are the key properties of benzene-1,3-diamine;hydrate?
benzene-1,3-diamine;hydrate has a molecular weight of 126.16 g/mol, XLogP of 0.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diamine;hydrate is sourced from PubChem (CID 133188498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).