About CID 141280926
CID 141280926 (PubChem CID 141280926) has the molecular formula C6H6NSe
and a molecular weight of 171.08 g/mol.
Molecular Properties
| Compound Name | CID 141280926 |
| PubChem CID | 141280926 |
| Molecular Formula | C6H6NSe |
| Molecular Weight | 171.08 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | — |
| SMILES | Nc1cccc([Se])c1 |
| InChI | InChI=1S/C6H6NSe/c7-5-2-1-3-6(8)4-5/h1-4H,7H2 |
| InChIKey | OXILFRVVZWFDDM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.08 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 141280926 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 141280926?
The IUPAC name of CID 141280926 (CID 141280926) is not available.
What is the SMILES notation for CID 141280926?
The canonical SMILES for CID 141280926 is Nc1cccc([Se])c1.
What is the InChIKey of CID 141280926?
The InChIKey is OXILFRVVZWFDDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NSe/c7-5-2-1-3-6(8)4-5/h1-4H,7H2.
What are the key properties of CID 141280926?
CID 141280926 has a molecular weight of 171.08 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 141280926 is sourced from PubChem (CID 141280926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).