About 3-methylaniline chloride
3-methylaniline chloride (PubChem CID 23334103) has the molecular formula C7H9ClN-
and a molecular weight of 142.61 g/mol. Its IUPAC name is 3-methylaniline chloride.
Molecular Properties
| Compound Name | 3-methylaniline chloride |
| PubChem CID | 23334103 |
| Molecular Formula | C7H9ClN- |
| Molecular Weight | 142.61 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 3-methylaniline chloride |
| SMILES | Cc1cccc(N)c1.[Cl-] |
| InChI | InChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H/p-1 |
| InChIKey | VDXZPXIEEVOGLV-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.61 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylaniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylaniline chloride?
The IUPAC name of 3-methylaniline chloride (CID 23334103) is 3-methylaniline chloride.
What is the SMILES notation for 3-methylaniline chloride?
The canonical SMILES for 3-methylaniline chloride is Cc1cccc(N)c1.[Cl-].
What is the InChIKey of 3-methylaniline chloride?
The InChIKey is VDXZPXIEEVOGLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H/p-1.
What are the key properties of 3-methylaniline chloride?
3-methylaniline chloride has a molecular weight of 142.61 g/mol, XLogP of -1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylaniline chloride is sourced from PubChem (CID 23334103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).