3-methylaniline chloride

C7H9ClN- — CID 23334103

IUPAC3-methylaniline chloride
SMILESCc1cccc(N)c1.[Cl-]
InChIInChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H/p-1
InChIKeyVDXZPXIEEVOGLV-UHFFFAOYSA-M
MW142.61 g/mol
LogP-1.42
Rot. Bonds

About 3-methylaniline chloride

3-methylaniline chloride (PubChem CID 23334103) has the molecular formula C7H9ClN- and a molecular weight of 142.61 g/mol. Its IUPAC name is 3-methylaniline chloride.

Molecular Properties

Compound Name3-methylaniline chloride
PubChem CID23334103
Molecular FormulaC7H9ClN-
Molecular Weight142.61 g/mol
Exact Mass142.04
IUPAC Name3-methylaniline chloride
SMILESCc1cccc(N)c1.[Cl-]
InChIInChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H/p-1
InChIKeyVDXZPXIEEVOGLV-UHFFFAOYSA-M
XLogP-1.42
TPSA26.02 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.61
LogP ≤ 5-1.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-methylaniline chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylaniline chloride?
The IUPAC name of 3-methylaniline chloride (CID 23334103) is 3-methylaniline chloride.
What is the SMILES notation for 3-methylaniline chloride?
The canonical SMILES for 3-methylaniline chloride is Cc1cccc(N)c1.[Cl-].
What is the InChIKey of 3-methylaniline chloride?
The InChIKey is VDXZPXIEEVOGLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9N.ClH/c1-6-3-2-4-7(8)5-6;/h2-5H,8H2,1H3;1H/p-1.
What are the key properties of 3-methylaniline chloride?
3-methylaniline chloride has a molecular weight of 142.61 g/mol, XLogP of -1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylaniline chloride is sourced from PubChem (CID 23334103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).