About aniline;3-methylaniline
aniline;3-methylaniline (PubChem CID 70490422) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is aniline;3-methylaniline.
Molecular Properties
| Compound Name | aniline;3-methylaniline |
| PubChem CID | 70490422 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | aniline;3-methylaniline |
| SMILES | Cc1cccc(N)c1.Nc1ccccc1 |
| InChI | InChI=1S/C7H9N.C6H7N/c1-6-3-2-4-7(8)5-6;7-6-4-2-1-3-5-6/h2-5H,8H2,1H3;1-5H,7H2 |
| InChIKey | MQFQIIGRFXESTM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;3-methylaniline?
The IUPAC name of aniline;3-methylaniline (CID 70490422) is aniline;3-methylaniline.
What is the SMILES notation for aniline;3-methylaniline?
The canonical SMILES for aniline;3-methylaniline is Cc1cccc(N)c1.Nc1ccccc1.
What is the InChIKey of aniline;3-methylaniline?
The InChIKey is MQFQIIGRFXESTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H7N/c1-6-3-2-4-7(8)5-6;7-6-4-2-1-3-5-6/h2-5H,8H2,1H3;1-5H,7H2.
What are the key properties of aniline;3-methylaniline?
aniline;3-methylaniline has a molecular weight of 200.28 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;3-methylaniline is sourced from PubChem (CID 70490422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).