About but-1-yne;3-methylaniline
but-1-yne;3-methylaniline (PubChem CID 158449016) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is but-1-yne;3-methylaniline.
Molecular Properties
| Compound Name | but-1-yne;3-methylaniline |
| PubChem CID | 158449016 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | but-1-yne;3-methylaniline |
| SMILES | C#CCC.Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N.C4H6/c1-6-3-2-4-7(8)5-6;1-3-4-2/h2-5H,8H2,1H3;1H,4H2,2H3 |
| InChIKey | HDTBMJGQQPASDZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-yne;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-yne;3-methylaniline?
The IUPAC name of but-1-yne;3-methylaniline (CID 158449016) is but-1-yne;3-methylaniline.
What is the SMILES notation for but-1-yne;3-methylaniline?
The canonical SMILES for but-1-yne;3-methylaniline is C#CCC.Cc1cccc(N)c1.
What is the InChIKey of but-1-yne;3-methylaniline?
The InChIKey is HDTBMJGQQPASDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C4H6/c1-6-3-2-4-7(8)5-6;1-3-4-2/h2-5H,8H2,1H3;1H,4H2,2H3.
What are the key properties of but-1-yne;3-methylaniline?
but-1-yne;3-methylaniline has a molecular weight of 161.25 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-yne;3-methylaniline is sourced from PubChem (CID 158449016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).