About 3-methylaniline;sulfurous acid
3-methylaniline;sulfurous acid (PubChem CID 70507221) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-methylaniline;sulfurous acid.
Molecular Properties
| Compound Name | 3-methylaniline;sulfurous acid |
| PubChem CID | 70507221 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-methylaniline;sulfurous acid |
| SMILES | Cc1cccc(N)c1.O=S(O)O |
| InChI | InChI=1S/C7H9N.H2O3S/c1-6-3-2-4-7(8)5-6;1-4(2)3/h2-5H,8H2,1H3;(H2,1,2,3) |
| InChIKey | DCJKRDYMVXAPSA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methylaniline;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylaniline;sulfurous acid?
The IUPAC name of 3-methylaniline;sulfurous acid (CID 70507221) is 3-methylaniline;sulfurous acid.
What is the SMILES notation for 3-methylaniline;sulfurous acid?
The canonical SMILES for 3-methylaniline;sulfurous acid is Cc1cccc(N)c1.O=S(O)O.
What is the InChIKey of 3-methylaniline;sulfurous acid?
The InChIKey is DCJKRDYMVXAPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.H2O3S/c1-6-3-2-4-7(8)5-6;1-4(2)3/h2-5H,8H2,1H3;(H2,1,2,3).
What are the key properties of 3-methylaniline;sulfurous acid?
3-methylaniline;sulfurous acid has a molecular weight of 189.24 g/mol, XLogP of 1.26, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylaniline;sulfurous acid is sourced from PubChem (CID 70507221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).