About tert-butyl(hydroxy)carbamic acid;3-methylaniline
tert-butyl(hydroxy)carbamic acid;3-methylaniline (PubChem CID 87265135) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl(hydroxy)carbamic acid;3-methylaniline.
Molecular Properties
| Compound Name | tert-butyl(hydroxy)carbamic acid;3-methylaniline |
| PubChem CID | 87265135 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl(hydroxy)carbamic acid;3-methylaniline |
| SMILES | CC(C)(C)N(O)C(=O)O.Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N.C5H11NO3/c1-6-3-2-4-7(8)5-6;1-5(2,3)6(9)4(7)8/h2-5H,8H2,1H3;9H,1-3H3,(H,7,8) |
| InChIKey | ZRXLHCPRVNJBLN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(hydroxy)carbamic acid;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(hydroxy)carbamic acid;3-methylaniline?
The IUPAC name of tert-butyl(hydroxy)carbamic acid;3-methylaniline (CID 87265135) is tert-butyl(hydroxy)carbamic acid;3-methylaniline.
What is the SMILES notation for tert-butyl(hydroxy)carbamic acid;3-methylaniline?
The canonical SMILES for tert-butyl(hydroxy)carbamic acid;3-methylaniline is CC(C)(C)N(O)C(=O)O.Cc1cccc(N)c1.
What is the InChIKey of tert-butyl(hydroxy)carbamic acid;3-methylaniline?
The InChIKey is ZRXLHCPRVNJBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C5H11NO3/c1-6-3-2-4-7(8)5-6;1-5(2,3)6(9)4(7)8/h2-5H,8H2,1H3;9H,1-3H3,(H,7,8).
What are the key properties of tert-butyl(hydroxy)carbamic acid;3-methylaniline?
tert-butyl(hydroxy)carbamic acid;3-methylaniline has a molecular weight of 240.30 g/mol, XLogP of 2.73, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(hydroxy)carbamic acid;3-methylaniline is sourced from PubChem (CID 87265135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).