C15H25NO2 — CID 175568368
di(propan-2-yl)carbamic acid;1,3-xylene (PubChem CID 175568368) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is di(propan-2-yl)carbamic acid;1,3-xylene.
| Compound Name | di(propan-2-yl)carbamic acid;1,3-xylene |
|---|---|
| PubChem CID | 175568368 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | di(propan-2-yl)carbamic acid;1,3-xylene |
| SMILES | CC(C)N(C(=O)O)C(C)C.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C7H15NO2/c1-7-4-3-5-8(2)6-7;1-5(2)8(6(3)4)7(9)10/h3-6H,1-2H3;5-6H,1-4H3,(H,9,10) |
| InChIKey | NGMWEULVHBLHEJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |