About oxaldehydic acid;1,3-xylene
oxaldehydic acid;1,3-xylene (PubChem CID 175563573) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is oxaldehydic acid;1,3-xylene.
Molecular Properties
| Compound Name | oxaldehydic acid;1,3-xylene |
| PubChem CID | 175563573 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | oxaldehydic acid;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=CC(=O)O |
| InChI | InChI=1S/C8H10.C2H2O3/c1-7-4-3-5-8(2)6-7;3-1-2(4)5/h3-6H,1-2H3;1H,(H,4,5) |
| InChIKey | GAICYLLHXSPPLS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxaldehydic acid;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxaldehydic acid;1,3-xylene?
The IUPAC name of oxaldehydic acid;1,3-xylene (CID 175563573) is oxaldehydic acid;1,3-xylene.
What is the SMILES notation for oxaldehydic acid;1,3-xylene?
The canonical SMILES for oxaldehydic acid;1,3-xylene is Cc1cccc(C)c1.O=CC(=O)O.
What is the InChIKey of oxaldehydic acid;1,3-xylene?
The InChIKey is GAICYLLHXSPPLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2H2O3/c1-7-4-3-5-8(2)6-7;3-1-2(4)5/h3-6H,1-2H3;1H,(H,4,5).
What are the key properties of oxaldehydic acid;1,3-xylene?
oxaldehydic acid;1,3-xylene has a molecular weight of 180.20 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxaldehydic acid;1,3-xylene is sourced from PubChem (CID 175563573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).