C11H17NO — CID 175545564
N,N-dimethylformamide;1,3-xylene (PubChem CID 175545564) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N,N-dimethylformamide;1,3-xylene.
| Compound Name | N,N-dimethylformamide;1,3-xylene |
|---|---|
| PubChem CID | 175545564 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-dimethylformamide;1,3-xylene |
| SMILES | CN(C)C=O.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C3H7NO/c1-7-4-3-5-8(2)6-7;1-4(2)3-5/h3-6H,1-2H3;3H,1-2H3 |
| InChIKey | UQTCQWHVAFCARE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|