About acetic acid;azane;1,3-xylene
acetic acid;azane;1,3-xylene (PubChem CID 21426934) has the molecular formula C12H24N2O4
and a molecular weight of 260.33 g/mol. Its IUPAC name is acetic acid;azane;1,3-xylene.
Molecular Properties
| Compound Name | acetic acid;azane;1,3-xylene |
| PubChem CID | 21426934 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | acetic acid;azane;1,3-xylene |
| SMILES | CC(=O)O.CC(=O)O.Cc1cccc(C)c1.N.N |
| InChI | InChI=1S/C8H10.2C2H4O2.2H3N/c1-7-4-3-5-8(2)6-7;2*1-2(3)4;;/h3-6H,1-2H3;2*1H3,(H,3,4);2*1H3 |
| InChIKey | XVXIIWOFIBPTOJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;azane;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;azane;1,3-xylene?
The IUPAC name of acetic acid;azane;1,3-xylene (CID 21426934) is acetic acid;azane;1,3-xylene.
What is the SMILES notation for acetic acid;azane;1,3-xylene?
The canonical SMILES for acetic acid;azane;1,3-xylene is CC(=O)O.CC(=O)O.Cc1cccc(C)c1.N.N.
What is the InChIKey of acetic acid;azane;1,3-xylene?
The InChIKey is XVXIIWOFIBPTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C2H4O2.2H3N/c1-7-4-3-5-8(2)6-7;2*1-2(3)4;;/h3-6H,1-2H3;2*1H3,(H,3,4);2*1H3.
What are the key properties of acetic acid;azane;1,3-xylene?
acetic acid;azane;1,3-xylene has a molecular weight of 260.33 g/mol, XLogP of 2.81, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;azane;1,3-xylene is sourced from PubChem (CID 21426934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).