C6H9ClN2O4 — CID 71405376
benzene-1,3-diamine;perchloric acid (PubChem CID 71405376) has the molecular formula C6H9ClN2O4 and a molecular weight of 208.60 g/mol. Its IUPAC name is benzene-1,3-diamine;perchloric acid.
| Compound Name | benzene-1,3-diamine;perchloric acid |
|---|---|
| PubChem CID | 71405376 |
| Molecular Formula | C6H9ClN2O4 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | benzene-1,3-diamine;perchloric acid |
| SMILES | Nc1cccc(N)c1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H8N2.ClHO4/c7-5-2-1-3-6(8)4-5;2-1(3,4)5/h1-4H,7-8H2;(H,2,3,4,5) |
| InChIKey | BZWROHOXEWZENX-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|