About 3-aminobenzenethiol;methanol
3-aminobenzenethiol;methanol (PubChem CID 145250249) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is 3-aminobenzenethiol;methanol.
Molecular Properties
| Compound Name | 3-aminobenzenethiol;methanol |
| PubChem CID | 145250249 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 3-aminobenzenethiol;methanol |
| SMILES | CO.Nc1cccc(S)c1 |
| InChI | InChI=1S/C6H7NS.CH4O/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H,7H2;2H,1H3 |
| InChIKey | XHDFFVCSXXOTQT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzenethiol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzenethiol;methanol?
The IUPAC name of 3-aminobenzenethiol;methanol (CID 145250249) is 3-aminobenzenethiol;methanol.
What is the SMILES notation for 3-aminobenzenethiol;methanol?
The canonical SMILES for 3-aminobenzenethiol;methanol is CO.Nc1cccc(S)c1.
What is the InChIKey of 3-aminobenzenethiol;methanol?
The InChIKey is XHDFFVCSXXOTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS.CH4O/c7-5-2-1-3-6(8)4-5;1-2/h1-4,8H,7H2;2H,1H3.
What are the key properties of 3-aminobenzenethiol;methanol?
3-aminobenzenethiol;methanol has a molecular weight of 157.24 g/mol, XLogP of 1.17, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzenethiol;methanol is sourced from PubChem (CID 145250249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).