About 3-phosphanylaniline;hydrate
3-phosphanylaniline;hydrate (PubChem CID 172853905) has the molecular formula C6H10NOP
and a molecular weight of 143.13 g/mol. Its IUPAC name is 3-phosphanylaniline;hydrate.
Molecular Properties
| Compound Name | 3-phosphanylaniline;hydrate |
| PubChem CID | 172853905 |
| Molecular Formula | C6H10NOP |
| Molecular Weight | 143.13 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3-phosphanylaniline;hydrate |
| SMILES | Nc1cccc(P)c1.O |
| InChI | InChI=1S/C6H8NP.H2O/c7-5-2-1-3-6(8)4-5;/h1-4H,7-8H2;1H2 |
| InChIKey | JWZNXUZZUSOBLJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.13 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphanylaniline;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphanylaniline;hydrate?
The IUPAC name of 3-phosphanylaniline;hydrate (CID 172853905) is 3-phosphanylaniline;hydrate.
What is the SMILES notation for 3-phosphanylaniline;hydrate?
The canonical SMILES for 3-phosphanylaniline;hydrate is Nc1cccc(P)c1.O.
What is the InChIKey of 3-phosphanylaniline;hydrate?
The InChIKey is JWZNXUZZUSOBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NP.H2O/c7-5-2-1-3-6(8)4-5;/h1-4H,7-8H2;1H2.
What are the key properties of 3-phosphanylaniline;hydrate?
3-phosphanylaniline;hydrate has a molecular weight of 143.13 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphanylaniline;hydrate is sourced from PubChem (CID 172853905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).