About 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine
3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine (PubChem CID 174818324) has the molecular formula C24H30N6O2
and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine.
Molecular Properties
| Compound Name | 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine |
| PubChem CID | 174818324 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine |
| SMILES | Nc1ccc(N)cc1.Nc1ccc(O)cc1.Nc1cccc(N)c1.Nc1cccc(O)c1 |
| InChI | InChI=1S/2C6H8N2.2C6H7NO/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5;7-5-1-3-6(8)4-2-5;7-5-2-1-3-6(8)4-5/h2*1-4H,7-8H2;2*1-4,8H,7H2 |
| InChIKey | HFDPAHLTEOTEMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 196.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine?
The IUPAC name of 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine (CID 174818324) is 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine.
What is the SMILES notation for 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine?
The canonical SMILES for 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine is Nc1ccc(N)cc1.Nc1ccc(O)cc1.Nc1cccc(N)c1.Nc1cccc(O)c1.
What is the InChIKey of 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine?
The InChIKey is HFDPAHLTEOTEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H8N2.2C6H7NO/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5;7-5-1-3-6(8)4-2-5;7-5-2-1-3-6(8)4-5/h2*1-4H,7-8H2;2*1-4,8H,7H2.
What are the key properties of 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine?
3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine has a molecular weight of 434.54 g/mol, XLogP of 3.65, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine is sourced from PubChem (CID 174818324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).