C24H30N6O2 — CID 174818324
3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine (PubChem CID 174818324) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine.
| Compound Name | 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine |
|---|---|
| PubChem CID | 174818324 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 3-aminophenol;4-aminophenol;benzene-1,3-diamine;benzene-1,4-diamine |
| SMILES | Nc1ccc(N)cc1.Nc1ccc(O)cc1.Nc1cccc(N)c1.Nc1cccc(O)c1 |
| InChI | InChI=1S/2C6H8N2.2C6H7NO/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5;7-5-1-3-6(8)4-2-5;7-5-2-1-3-6(8)4-5/h2*1-4H,7-8H2;2*1-4,8H,7H2 |
| InChIKey | HFDPAHLTEOTEMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 196.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|