About 3-aminophenol;2-methylpropanoic acid
3-aminophenol;2-methylpropanoic acid (PubChem CID 70507875) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-aminophenol;2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-aminophenol;2-methylpropanoic acid |
| PubChem CID | 70507875 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-aminophenol;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.Nc1cccc(O)c1 |
| InChI | InChI=1S/C6H7NO.C4H8O2/c7-5-2-1-3-6(8)4-5;1-3(2)4(5)6/h1-4,8H,7H2;3H,1-2H3,(H,5,6) |
| InChIKey | RZWZFTIVHWILCS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminophenol;2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminophenol;2-methylpropanoic acid?
The IUPAC name of 3-aminophenol;2-methylpropanoic acid (CID 70507875) is 3-aminophenol;2-methylpropanoic acid.
What is the SMILES notation for 3-aminophenol;2-methylpropanoic acid?
The canonical SMILES for 3-aminophenol;2-methylpropanoic acid is CC(C)C(=O)O.Nc1cccc(O)c1.
What is the InChIKey of 3-aminophenol;2-methylpropanoic acid?
The InChIKey is RZWZFTIVHWILCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C4H8O2/c7-5-2-1-3-6(8)4-5;1-3(2)4(5)6/h1-4,8H,7H2;3H,1-2H3,(H,5,6).
What are the key properties of 3-aminophenol;2-methylpropanoic acid?
3-aminophenol;2-methylpropanoic acid has a molecular weight of 197.23 g/mol, XLogP of 1.70, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminophenol;2-methylpropanoic acid is sourced from PubChem (CID 70507875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).