3-aminophenol;2-methylpropanoic acid

C10H15NO3 — CID 70507875

IUPAC3-aminophenol;2-methylpropanoic acid
SMILESCC(C)C(=O)O.Nc1cccc(O)c1
InChIInChI=1S/C6H7NO.C4H8O2/c7-5-2-1-3-6(8)4-5;1-3(2)4(5)6/h1-4,8H,7H2;3H,1-2H3,(H,5,6)
InChIKeyRZWZFTIVHWILCS-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.70
Rot. Bonds1

About 3-aminophenol;2-methylpropanoic acid

3-aminophenol;2-methylpropanoic acid (PubChem CID 70507875) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-aminophenol;2-methylpropanoic acid.

Molecular Properties

Compound Name3-aminophenol;2-methylpropanoic acid
PubChem CID70507875
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name3-aminophenol;2-methylpropanoic acid
SMILESCC(C)C(=O)O.Nc1cccc(O)c1
InChIInChI=1S/C6H7NO.C4H8O2/c7-5-2-1-3-6(8)4-5;1-3(2)4(5)6/h1-4,8H,7H2;3H,1-2H3,(H,5,6)
InChIKeyRZWZFTIVHWILCS-UHFFFAOYSA-N
XLogP1.70
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-aminophenol;2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-aminophenol;2-methylpropanoic acid?
The IUPAC name of 3-aminophenol;2-methylpropanoic acid (CID 70507875) is 3-aminophenol;2-methylpropanoic acid.
What is the SMILES notation for 3-aminophenol;2-methylpropanoic acid?
The canonical SMILES for 3-aminophenol;2-methylpropanoic acid is CC(C)C(=O)O.Nc1cccc(O)c1.
What is the InChIKey of 3-aminophenol;2-methylpropanoic acid?
The InChIKey is RZWZFTIVHWILCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C4H8O2/c7-5-2-1-3-6(8)4-5;1-3(2)4(5)6/h1-4,8H,7H2;3H,1-2H3,(H,5,6).
What are the key properties of 3-aminophenol;2-methylpropanoic acid?
3-aminophenol;2-methylpropanoic acid has a molecular weight of 197.23 g/mol, XLogP of 1.70, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminophenol;2-methylpropanoic acid is sourced from PubChem (CID 70507875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).