About 3-aminobenzoic acid;azane
3-aminobenzoic acid;azane (PubChem CID 159954068) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-aminobenzoic acid;azane.
Molecular Properties
| Compound Name | 3-aminobenzoic acid;azane |
| PubChem CID | 159954068 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-aminobenzoic acid;azane |
| SMILES | N.Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO2.H3N/c8-6-3-1-2-5(4-6)7(9)10;/h1-4H,8H2,(H,9,10);1H3 |
| InChIKey | OCMIMTGYXLLDHV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzoic acid;azane?
The IUPAC name of 3-aminobenzoic acid;azane (CID 159954068) is 3-aminobenzoic acid;azane.
What is the SMILES notation for 3-aminobenzoic acid;azane?
The canonical SMILES for 3-aminobenzoic acid;azane is N.Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-aminobenzoic acid;azane?
The InChIKey is OCMIMTGYXLLDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.H3N/c8-6-3-1-2-5(4-6)7(9)10;/h1-4H,8H2,(H,9,10);1H3.
What are the key properties of 3-aminobenzoic acid;azane?
3-aminobenzoic acid;azane has a molecular weight of 154.17 g/mol, XLogP of 1.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzoic acid;azane is sourced from PubChem (CID 159954068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).