About 3-aminobenzoic acid;ethoxyethane
3-aminobenzoic acid;ethoxyethane (PubChem CID 70021717) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-aminobenzoic acid;ethoxyethane.
Molecular Properties
| Compound Name | 3-aminobenzoic acid;ethoxyethane |
| PubChem CID | 70021717 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-aminobenzoic acid;ethoxyethane |
| SMILES | CCOCC.Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO2.C4H10O/c8-6-3-1-2-5(4-6)7(9)10;1-3-5-4-2/h1-4H,8H2,(H,9,10);3-4H2,1-2H3 |
| InChIKey | DLDINWYRMWJOPK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzoic acid;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzoic acid;ethoxyethane?
The IUPAC name of 3-aminobenzoic acid;ethoxyethane (CID 70021717) is 3-aminobenzoic acid;ethoxyethane.
What is the SMILES notation for 3-aminobenzoic acid;ethoxyethane?
The canonical SMILES for 3-aminobenzoic acid;ethoxyethane is CCOCC.Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-aminobenzoic acid;ethoxyethane?
The InChIKey is DLDINWYRMWJOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C4H10O/c8-6-3-1-2-5(4-6)7(9)10;1-3-5-4-2/h1-4H,8H2,(H,9,10);3-4H2,1-2H3.
What are the key properties of 3-aminobenzoic acid;ethoxyethane?
3-aminobenzoic acid;ethoxyethane has a molecular weight of 211.26 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzoic acid;ethoxyethane is sourced from PubChem (CID 70021717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).