C13H19NO — CID 151174957
1-(3-aminophenyl)-2,2-dimethylpentan-1-one (PubChem CID 151174957) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2,2-dimethylpentan-1-one.
| Compound Name | 1-(3-aminophenyl)-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 151174957 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(3-aminophenyl)-2,2-dimethylpentan-1-one |
| SMILES | CCCC(C)(C)C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C13H19NO/c1-4-8-13(2,3)12(15)10-6-5-7-11(14)9-10/h5-7,9H,4,8,14H2,1-3H3 |
| InChIKey | NDBOQTVHMRJVMM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|