About (3-aminobenzoyl)azanium
(3-aminobenzoyl)azanium (PubChem CID 142343873) has the molecular formula C7H9N2O+
and a molecular weight of 137.16 g/mol. Its IUPAC name is (3-aminobenzoyl)azanium.
Molecular Properties
| Compound Name | (3-aminobenzoyl)azanium |
| PubChem CID | 142343873 |
| Molecular Formula | C7H9N2O+ |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | (3-aminobenzoyl)azanium |
| SMILES | Nc1cccc(C([NH3+])=O)c1 |
| InChI | InChI=1S/C7H8N2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H2,9,10)/p+1 |
| InChIKey | GSCPDZHWVNUUFI-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-aminobenzoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminobenzoyl)azanium?
The IUPAC name of (3-aminobenzoyl)azanium (CID 142343873) is (3-aminobenzoyl)azanium.
What is the SMILES notation for (3-aminobenzoyl)azanium?
The canonical SMILES for (3-aminobenzoyl)azanium is Nc1cccc(C([NH3+])=O)c1.
What is the InChIKey of (3-aminobenzoyl)azanium?
The InChIKey is GSCPDZHWVNUUFI-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H8N2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H2,9,10)/p+1.
What are the key properties of (3-aminobenzoyl)azanium?
(3-aminobenzoyl)azanium has a molecular weight of 137.16 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminobenzoyl)azanium is sourced from PubChem (CID 142343873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).