About Methanone, (3-aminophenyl)phenyl-
Methanone, (3-aminophenyl)phenyl- (PubChem CID 17817) has the molecular formula C13H11NO
and a molecular weight of 197.23 g/mol. Its IUPAC name is (3-aminophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | Methanone, (3-aminophenyl)phenyl- |
| PubChem CID | 17817 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (3-aminophenyl)-phenylmethanone |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)N |
| InChI | InChI=1S/C13H11NO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H,14H2 |
| InChIKey | FUADXEJBHCKVBN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 221 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Methanone, (3-aminophenyl)phenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methanone, (3-aminophenyl)phenyl-?
The IUPAC name of Methanone, (3-aminophenyl)phenyl- (CID 17817) is (3-aminophenyl)-phenylmethanone.
What is the SMILES notation for Methanone, (3-aminophenyl)phenyl-?
The canonical SMILES for Methanone, (3-aminophenyl)phenyl- is C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)N.
What is the InChIKey of Methanone, (3-aminophenyl)phenyl-?
The InChIKey is FUADXEJBHCKVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H,14H2.
What are the key properties of Methanone, (3-aminophenyl)phenyl-?
Methanone, (3-aminophenyl)phenyl- has a molecular weight of 197.23 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Methanone, (3-aminophenyl)phenyl- is sourced from PubChem (CID 17817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).