C14H20O2 — CID 118136749
1-[3-(hydroxymethyl)phenyl]-2,2-dimethylpentan-1-one (PubChem CID 118136749) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)phenyl]-2,2-dimethylpentan-1-one.
| Compound Name | 1-[3-(hydroxymethyl)phenyl]-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 118136749 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-[3-(hydroxymethyl)phenyl]-2,2-dimethylpentan-1-one |
| SMILES | CCCC(C)(C)C(=O)c1cccc(CO)c1 |
| InChI | InChI=1S/C14H20O2/c1-4-8-14(2,3)13(16)12-7-5-6-11(9-12)10-15/h5-7,9,15H,4,8,10H2,1-3H3 |
| InChIKey | LJJGOYYPLJVIML-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |