About 3-ethylbenzoic acid;propane
3-ethylbenzoic acid;propane (PubChem CID 177324794) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-ethylbenzoic acid;propane.
Molecular Properties
| Compound Name | 3-ethylbenzoic acid;propane |
| PubChem CID | 177324794 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-ethylbenzoic acid;propane |
| SMILES | CCC.CCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10O2.C3H8/c1-2-7-4-3-5-8(6-7)9(10)11;1-3-2/h3-6H,2H2,1H3,(H,10,11);3H2,1-2H3 |
| InChIKey | XHURDCJRCVAIKY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethylbenzoic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylbenzoic acid;propane?
The IUPAC name of 3-ethylbenzoic acid;propane (CID 177324794) is 3-ethylbenzoic acid;propane.
What is the SMILES notation for 3-ethylbenzoic acid;propane?
The canonical SMILES for 3-ethylbenzoic acid;propane is CCC.CCc1cccc(C(=O)O)c1.
What is the InChIKey of 3-ethylbenzoic acid;propane?
The InChIKey is XHURDCJRCVAIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C3H8/c1-2-7-4-3-5-8(6-7)9(10)11;1-3-2/h3-6H,2H2,1H3,(H,10,11);3H2,1-2H3.
What are the key properties of 3-ethylbenzoic acid;propane?
3-ethylbenzoic acid;propane has a molecular weight of 194.27 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylbenzoic acid;propane is sourced from PubChem (CID 177324794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).