About chloro 3-ethylbenzoate
chloro 3-ethylbenzoate (PubChem CID 142246460) has the molecular formula C9H9ClO2
and a molecular weight of 184.62 g/mol. Its IUPAC name is chloro 3-ethylbenzoate.
Molecular Properties
| Compound Name | chloro 3-ethylbenzoate |
| PubChem CID | 142246460 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | chloro 3-ethylbenzoate |
| SMILES | CCc1cccc(C(=O)OCl)c1 |
| InChI | InChI=1S/C9H9ClO2/c1-2-7-4-3-5-8(6-7)9(11)12-10/h3-6H,2H2,1H3 |
| InChIKey | FGTOBGIVMYBGSA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro 3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 3-ethylbenzoate?
The IUPAC name of chloro 3-ethylbenzoate (CID 142246460) is chloro 3-ethylbenzoate.
What is the SMILES notation for chloro 3-ethylbenzoate?
The canonical SMILES for chloro 3-ethylbenzoate is CCc1cccc(C(=O)OCl)c1.
What is the InChIKey of chloro 3-ethylbenzoate?
The InChIKey is FGTOBGIVMYBGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO2/c1-2-7-4-3-5-8(6-7)9(11)12-10/h3-6H,2H2,1H3.
What are the key properties of chloro 3-ethylbenzoate?
chloro 3-ethylbenzoate has a molecular weight of 184.62 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 3-ethylbenzoate is sourced from PubChem (CID 142246460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).