C12H17NO — CID 89250993
N,3-diethyl-N-methylbenzamide (PubChem CID 89250993) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N,3-diethyl-N-methylbenzamide.
| Compound Name | N,3-diethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 89250993 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N,3-diethyl-N-methylbenzamide |
| SMILES | CCc1cccc(C(=O)N(C)CC)c1 |
| InChI | InChI=1S/C12H17NO/c1-4-10-7-6-8-11(9-10)12(14)13(3)5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | WIDBZDJWYBIXIY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |