C18H20O3 — CID 67496620
1,2-diphenylethane-1,2-dione;ethoxyethane (PubChem CID 67496620) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;ethoxyethane.
| Compound Name | 1,2-diphenylethane-1,2-dione;ethoxyethane |
|---|---|
| PubChem CID | 67496620 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;ethoxyethane |
| SMILES | CCOCC.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C4H10O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;3-4H2,1-2H3 |
| InChIKey | VESKWLKWDXCHJK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|