About ethoxyethane benzoate
ethoxyethane benzoate (PubChem CID 22178435) has the molecular formula C11H15O3-
and a molecular weight of 195.24 g/mol. Its IUPAC name is ethoxyethane benzoate.
Molecular Properties
| Compound Name | ethoxyethane benzoate |
| PubChem CID | 22178435 |
| Molecular Formula | C11H15O3- |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | ethoxyethane benzoate |
| SMILES | CCOCC.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C4H10O/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,8,9);3-4H2,1-2H3/p-1 |
| InChIKey | TXSFFZYXHRAMBM-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethoxyethane benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane benzoate?
The IUPAC name of ethoxyethane benzoate (CID 22178435) is ethoxyethane benzoate.
What is the SMILES notation for ethoxyethane benzoate?
The canonical SMILES for ethoxyethane benzoate is CCOCC.O=C([O-])c1ccccc1.
What is the InChIKey of ethoxyethane benzoate?
The InChIKey is TXSFFZYXHRAMBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O2.C4H10O/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,8,9);3-4H2,1-2H3/p-1.
What are the key properties of ethoxyethane benzoate?
ethoxyethane benzoate has a molecular weight of 195.24 g/mol, XLogP of 1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane benzoate is sourced from PubChem (CID 22178435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).