About aluminum dibenzoate
aluminum dibenzoate (PubChem CID 18679092) has the molecular formula C14H10AlO4+
and a molecular weight of 269.21 g/mol. Its IUPAC name is aluminum dibenzoate.
Molecular Properties
| Compound Name | aluminum dibenzoate |
| PubChem CID | 18679092 |
| Molecular Formula | C14H10AlO4+ |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | aluminum dibenzoate |
| SMILES | O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Al+3] |
| InChI | InChI=1S/2C7H6O2.Al/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+3/p-2 |
| InChIKey | RQNQYHSLWSFEEX-UHFFFAOYSA-L |
| XLogP | -0.28 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze aluminum dibenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum dibenzoate?
The IUPAC name of aluminum dibenzoate (CID 18679092) is aluminum dibenzoate.
What is the SMILES notation for aluminum dibenzoate?
The canonical SMILES for aluminum dibenzoate is O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Al+3].
What is the InChIKey of aluminum dibenzoate?
The InChIKey is RQNQYHSLWSFEEX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O2.Al/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+3/p-2.
What are the key properties of aluminum dibenzoate?
aluminum dibenzoate has a molecular weight of 269.21 g/mol, XLogP of -0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum dibenzoate is sourced from PubChem (CID 18679092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).