About calcium dibenzoate
calcium dibenzoate (PubChem CID 90470399) has the molecular formula C14H10CaO4
and a molecular weight of 282.31 g/mol. Its IUPAC name is calcium dibenzoate.
Molecular Properties
| Compound Name | calcium dibenzoate |
| PubChem CID | 90470399 |
| Molecular Formula | C14H10CaO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | calcium dibenzoate |
| SMILES | O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 |
| InChIKey | NSQPPSOSXWOZNH-UHFFFAOYSA-L |
| XLogP | -0.28 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium dibenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium dibenzoate?
The IUPAC name of calcium dibenzoate (CID 90470399) is calcium dibenzoate.
What is the SMILES notation for calcium dibenzoate?
The canonical SMILES for calcium dibenzoate is O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Ca+2].
What is the InChIKey of calcium dibenzoate?
The InChIKey is NSQPPSOSXWOZNH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2.
What are the key properties of calcium dibenzoate?
calcium dibenzoate has a molecular weight of 282.31 g/mol, XLogP of -0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium dibenzoate is sourced from PubChem (CID 90470399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).