About cadmium benzoate
cadmium benzoate (PubChem CID 170839001) has the molecular formula C7H5CdO2-
and a molecular weight of 233.53 g/mol. Its IUPAC name is cadmium benzoate.
Molecular Properties
| Compound Name | cadmium benzoate |
| PubChem CID | 170839001 |
| Molecular Formula | C7H5CdO2- |
| Molecular Weight | 233.53 g/mol |
| Exact Mass | 234.93 |
| IUPAC Name | cadmium benzoate |
| SMILES | O=C([O-])c1ccccc1.[Cd] |
| InChI | InChI=1S/C7H6O2.Cd/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/p-1 |
| InChIKey | DMDIGAARHVCCQF-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.53 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cadmium benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium benzoate?
The IUPAC name of cadmium benzoate (CID 170839001) is cadmium benzoate.
What is the SMILES notation for cadmium benzoate?
The canonical SMILES for cadmium benzoate is O=C([O-])c1ccccc1.[Cd].
What is the InChIKey of cadmium benzoate?
The InChIKey is DMDIGAARHVCCQF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O2.Cd/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/p-1.
What are the key properties of cadmium benzoate?
cadmium benzoate has a molecular weight of 233.53 g/mol, XLogP of 0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium benzoate is sourced from PubChem (CID 170839001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).