About azanium;ethanol;benzoate
azanium;ethanol;benzoate (PubChem CID 158099559) has the molecular formula C13H27NO5
and a molecular weight of 277.36 g/mol. Its IUPAC name is azanium;ethanol;benzoate.
Molecular Properties
| Compound Name | azanium;ethanol;benzoate |
| PubChem CID | 158099559 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | azanium;ethanol;benzoate |
| SMILES | CCO.CCO.CCO.O=C([O-])c1ccccc1.[NH4+] |
| InChI | InChI=1S/C7H6O2.3C2H6O.H3N/c8-7(9)6-4-2-1-3-5-6;3*1-2-3;/h1-5H,(H,8,9);3*3H,2H2,1H3;1H3 |
| InChIKey | KWAVPJKOUZCWCJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azanium;ethanol;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;ethanol;benzoate?
The IUPAC name of azanium;ethanol;benzoate (CID 158099559) is azanium;ethanol;benzoate.
What is the SMILES notation for azanium;ethanol;benzoate?
The canonical SMILES for azanium;ethanol;benzoate is CCO.CCO.CCO.O=C([O-])c1ccccc1.[NH4+].
What is the InChIKey of azanium;ethanol;benzoate?
The InChIKey is KWAVPJKOUZCWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.3C2H6O.H3N/c8-7(9)6-4-2-1-3-5-6;3*1-2-3;/h1-5H,(H,8,9);3*3H,2H2,1H3;1H3.
What are the key properties of azanium;ethanol;benzoate?
azanium;ethanol;benzoate has a molecular weight of 277.36 g/mol, XLogP of 0.42, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;ethanol;benzoate is sourced from PubChem (CID 158099559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).