About ethoxyethane;1-phenylethenylbenzene
ethoxyethane;1-phenylethenylbenzene (PubChem CID 69353422) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is ethoxyethane;1-phenylethenylbenzene.
Molecular Properties
| Compound Name | ethoxyethane;1-phenylethenylbenzene |
| PubChem CID | 69353422 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | ethoxyethane;1-phenylethenylbenzene |
| SMILES | C=C(c1ccccc1)c1ccccc1.CCOCC |
| InChI | InChI=1S/C14H12.C4H10O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-4-2/h2-11H,1H2;3-4H2,1-2H3 |
| InChIKey | FIMMFOIHAKAUDY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethoxyethane;1-phenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1-phenylethenylbenzene?
The IUPAC name of ethoxyethane;1-phenylethenylbenzene (CID 69353422) is ethoxyethane;1-phenylethenylbenzene.
What is the SMILES notation for ethoxyethane;1-phenylethenylbenzene?
The canonical SMILES for ethoxyethane;1-phenylethenylbenzene is C=C(c1ccccc1)c1ccccc1.CCOCC.
What is the InChIKey of ethoxyethane;1-phenylethenylbenzene?
The InChIKey is FIMMFOIHAKAUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C4H10O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-4-2/h2-11H,1H2;3-4H2,1-2H3.
What are the key properties of ethoxyethane;1-phenylethenylbenzene?
ethoxyethane;1-phenylethenylbenzene has a molecular weight of 254.37 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1-phenylethenylbenzene is sourced from PubChem (CID 69353422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).