About mercury(1+);1-phenylethenylbenzene;chloride
mercury(1+);1-phenylethenylbenzene;chloride (PubChem CID 171374959) has the molecular formula C14H12ClHg
and a molecular weight of 416.29 g/mol. Its IUPAC name is mercury(1+);1-phenylethenylbenzene;chloride.
Molecular Properties
| Compound Name | mercury(1+);1-phenylethenylbenzene;chloride |
| PubChem CID | 171374959 |
| Molecular Formula | C14H12ClHg |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | mercury(1+);1-phenylethenylbenzene;chloride |
| SMILES | C=C(c1ccccc1)c1ccccc1.[Cl-].[Hg+] |
| InChI | InChI=1S/C14H12.ClH.Hg/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;;/h2-11H,1H2;1H;/q;;+1/p-1 |
| InChIKey | BAFAOABLXIPLLB-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury(1+);1-phenylethenylbenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(1+);1-phenylethenylbenzene;chloride?
The IUPAC name of mercury(1+);1-phenylethenylbenzene;chloride (CID 171374959) is mercury(1+);1-phenylethenylbenzene;chloride.
What is the SMILES notation for mercury(1+);1-phenylethenylbenzene;chloride?
The canonical SMILES for mercury(1+);1-phenylethenylbenzene;chloride is C=C(c1ccccc1)c1ccccc1.[Cl-].[Hg+].
What is the InChIKey of mercury(1+);1-phenylethenylbenzene;chloride?
The InChIKey is BAFAOABLXIPLLB-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12.ClH.Hg/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;;/h2-11H,1H2;1H;/q;;+1/p-1.
What are the key properties of mercury(1+);1-phenylethenylbenzene;chloride?
mercury(1+);1-phenylethenylbenzene;chloride has a molecular weight of 416.29 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(1+);1-phenylethenylbenzene;chloride is sourced from PubChem (CID 171374959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).