About oxadiazole;1-phenylethenylbenzene
oxadiazole;1-phenylethenylbenzene (PubChem CID 174510453) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is oxadiazole;1-phenylethenylbenzene.
Molecular Properties
| Compound Name | oxadiazole;1-phenylethenylbenzene |
| PubChem CID | 174510453 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | oxadiazole;1-phenylethenylbenzene |
| SMILES | C=C(c1ccccc1)c1ccccc1.c1conn1 |
| InChI | InChI=1S/C14H12.C2H2N2O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-5-4-3-1/h2-11H,1H2;1-2H |
| InChIKey | BOTLMUJOSHROCJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxadiazole;1-phenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazole;1-phenylethenylbenzene?
The IUPAC name of oxadiazole;1-phenylethenylbenzene (CID 174510453) is oxadiazole;1-phenylethenylbenzene.
What is the SMILES notation for oxadiazole;1-phenylethenylbenzene?
The canonical SMILES for oxadiazole;1-phenylethenylbenzene is C=C(c1ccccc1)c1ccccc1.c1conn1.
What is the InChIKey of oxadiazole;1-phenylethenylbenzene?
The InChIKey is BOTLMUJOSHROCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C2H2N2O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-5-4-3-1/h2-11H,1H2;1-2H.
What are the key properties of oxadiazole;1-phenylethenylbenzene?
oxadiazole;1-phenylethenylbenzene has a molecular weight of 250.30 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazole;1-phenylethenylbenzene is sourced from PubChem (CID 174510453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).