About 1-phenylethenylbenzene;hydrochloride
1-phenylethenylbenzene;hydrochloride (PubChem CID 70400725) has the molecular formula C14H13Cl
and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-phenylethenylbenzene;hydrochloride.
Molecular Properties
| Compound Name | 1-phenylethenylbenzene;hydrochloride |
| PubChem CID | 70400725 |
| Molecular Formula | C14H13Cl |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-phenylethenylbenzene;hydrochloride |
| SMILES | C=C(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C14H12.ClH/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11H,1H2;1H |
| InChIKey | KPPZLPFWQIPIAB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-phenylethenylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenylbenzene;hydrochloride?
The IUPAC name of 1-phenylethenylbenzene;hydrochloride (CID 70400725) is 1-phenylethenylbenzene;hydrochloride.
What is the SMILES notation for 1-phenylethenylbenzene;hydrochloride?
The canonical SMILES for 1-phenylethenylbenzene;hydrochloride is C=C(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 1-phenylethenylbenzene;hydrochloride?
The InChIKey is KPPZLPFWQIPIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.ClH/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11H,1H2;1H.
What are the key properties of 1-phenylethenylbenzene;hydrochloride?
1-phenylethenylbenzene;hydrochloride has a molecular weight of 216.71 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenylbenzene;hydrochloride is sourced from PubChem (CID 70400725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).