About 1-phenylethenylbenzene;triazine
1-phenylethenylbenzene;triazine (PubChem CID 122635968) has the molecular formula C17H15N3
and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-phenylethenylbenzene;triazine.
Molecular Properties
| Compound Name | 1-phenylethenylbenzene;triazine |
| PubChem CID | 122635968 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-phenylethenylbenzene;triazine |
| SMILES | C=C(c1ccccc1)c1ccccc1.c1cnnnc1 |
| InChI | InChI=1S/C14H12.C3H3N3/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-4-6-5-3-1/h2-11H,1H2;1-3H |
| InChIKey | MUJWXSUCRPCIHO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylethenylbenzene;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenylbenzene;triazine?
The IUPAC name of 1-phenylethenylbenzene;triazine (CID 122635968) is 1-phenylethenylbenzene;triazine.
What is the SMILES notation for 1-phenylethenylbenzene;triazine?
The canonical SMILES for 1-phenylethenylbenzene;triazine is C=C(c1ccccc1)c1ccccc1.c1cnnnc1.
What is the InChIKey of 1-phenylethenylbenzene;triazine?
The InChIKey is MUJWXSUCRPCIHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C3H3N3/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-4-6-5-3-1/h2-11H,1H2;1-3H.
What are the key properties of 1-phenylethenylbenzene;triazine?
1-phenylethenylbenzene;triazine has a molecular weight of 261.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenylbenzene;triazine is sourced from PubChem (CID 122635968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).