About 1-phenylethanone;triazine
1-phenylethanone;triazine (PubChem CID 157268424) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-phenylethanone;triazine.
Molecular Properties
| Compound Name | 1-phenylethanone;triazine |
| PubChem CID | 157268424 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-phenylethanone;triazine |
| SMILES | CC(=O)c1ccccc1.c1cnnnc1 |
| InChI | InChI=1S/C8H8O.C3H3N3/c1-7(9)8-5-3-2-4-6-8;1-2-4-6-5-3-1/h2-6H,1H3;1-3H |
| InChIKey | AYGJQYXPFLSUFH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylethanone;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone;triazine?
The IUPAC name of 1-phenylethanone;triazine (CID 157268424) is 1-phenylethanone;triazine.
What is the SMILES notation for 1-phenylethanone;triazine?
The canonical SMILES for 1-phenylethanone;triazine is CC(=O)c1ccccc1.c1cnnnc1.
What is the InChIKey of 1-phenylethanone;triazine?
The InChIKey is AYGJQYXPFLSUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C3H3N3/c1-7(9)8-5-3-2-4-6-8;1-2-4-6-5-3-1/h2-6H,1H3;1-3H.
What are the key properties of 1-phenylethanone;triazine?
1-phenylethanone;triazine has a molecular weight of 201.23 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone;triazine is sourced from PubChem (CID 157268424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).