About potassium 1-phenylethenylbenzene
potassium 1-phenylethenylbenzene (PubChem CID 19358731) has the molecular formula C14H12K+
and a molecular weight of 219.35 g/mol. Its IUPAC name is potassium 1-phenylethenylbenzene.
Molecular Properties
| Compound Name | potassium 1-phenylethenylbenzene |
| PubChem CID | 19358731 |
| Molecular Formula | C14H12K+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | potassium 1-phenylethenylbenzene |
| SMILES | C=C(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C14H12.K/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11H,1H2;/q;+1 |
| InChIKey | DORKNPVXRUOMFH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium 1-phenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-phenylethenylbenzene?
The IUPAC name of potassium 1-phenylethenylbenzene (CID 19358731) is potassium 1-phenylethenylbenzene.
What is the SMILES notation for potassium 1-phenylethenylbenzene?
The canonical SMILES for potassium 1-phenylethenylbenzene is C=C(c1ccccc1)c1ccccc1.[K+].
What is the InChIKey of potassium 1-phenylethenylbenzene?
The InChIKey is DORKNPVXRUOMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.K/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11H,1H2;/q;+1.
What are the key properties of potassium 1-phenylethenylbenzene?
potassium 1-phenylethenylbenzene has a molecular weight of 219.35 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-phenylethenylbenzene is sourced from PubChem (CID 19358731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).