About 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine
1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine (PubChem CID 67437631) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine |
| PubChem CID | 67437631 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=C(c1ccccc1)c1ccccc1.C=CCNCC=C |
| InChI | InChI=1S/C14H12.C6H11N/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-7-6-4-2/h2-11H,1H2;3-4,7H,1-2,5-6H2 |
| InChIKey | GBHHQPWMULSJDE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine?
The IUPAC name of 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine (CID 67437631) is 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine.
What is the SMILES notation for 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine?
The canonical SMILES for 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine is C=C(c1ccccc1)c1ccccc1.C=CCNCC=C.
What is the InChIKey of 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine?
The InChIKey is GBHHQPWMULSJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C6H11N/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-7-6-4-2/h2-11H,1H2;3-4,7H,1-2,5-6H2.
What are the key properties of 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine?
1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine has a molecular weight of 277.41 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenylbenzene;N-prop-2-enylprop-2-en-1-amine is sourced from PubChem (CID 67437631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).