About phenol;1-phenylethenylbenzene
phenol;1-phenylethenylbenzene (PubChem CID 174309625) has the molecular formula C20H18O
and a molecular weight of 274.36 g/mol. Its IUPAC name is phenol;1-phenylethenylbenzene.
Molecular Properties
| Compound Name | phenol;1-phenylethenylbenzene |
| PubChem CID | 174309625 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | phenol;1-phenylethenylbenzene |
| SMILES | C=C(c1ccccc1)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C14H12.C6H6O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;7-6-4-2-1-3-5-6/h2-11H,1H2;1-5,7H |
| InChIKey | RUJDXHLHQLAWIP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenol;1-phenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;1-phenylethenylbenzene?
The IUPAC name of phenol;1-phenylethenylbenzene (CID 174309625) is phenol;1-phenylethenylbenzene.
What is the SMILES notation for phenol;1-phenylethenylbenzene?
The canonical SMILES for phenol;1-phenylethenylbenzene is C=C(c1ccccc1)c1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;1-phenylethenylbenzene?
The InChIKey is RUJDXHLHQLAWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C6H6O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;7-6-4-2-1-3-5-6/h2-11H,1H2;1-5,7H.
What are the key properties of phenol;1-phenylethenylbenzene?
phenol;1-phenylethenylbenzene has a molecular weight of 274.36 g/mol, XLogP of 5.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;1-phenylethenylbenzene is sourced from PubChem (CID 174309625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).