About 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine
1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine (PubChem CID 174913202) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine |
| PubChem CID | 174913202 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCNCC=C.CC(N)c1ccccc1 |
| InChI | InChI=1S/C8H11N.C6H11N/c1-7(9)8-5-3-2-4-6-8;1-3-5-7-6-4-2/h2-7H,9H2,1H3;3-4,7H,1-2,5-6H2 |
| InChIKey | GOQLTIDLGDOBOZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine?
The IUPAC name of 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine (CID 174913202) is 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine.
What is the SMILES notation for 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine?
The canonical SMILES for 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine is C=CCNCC=C.CC(N)c1ccccc1.
What is the InChIKey of 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine?
The InChIKey is GOQLTIDLGDOBOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H11N/c1-7(9)8-5-3-2-4-6-8;1-3-5-7-6-4-2/h2-7H,9H2,1H3;3-4,7H,1-2,5-6H2.
What are the key properties of 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine?
1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine has a molecular weight of 218.34 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanamine;N-prop-2-enylprop-2-en-1-amine is sourced from PubChem (CID 174913202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).