C14H17NO2 — CID 174442381
benzene-1,2-diol;1-phenylethanamine (PubChem CID 174442381) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is benzene-1,2-diol;1-phenylethanamine.
| Compound Name | benzene-1,2-diol;1-phenylethanamine |
|---|---|
| PubChem CID | 174442381 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | benzene-1,2-diol;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.Oc1ccccc1O |
| InChI | InChI=1S/C8H11N.C6H6O2/c1-7(9)8-5-3-2-4-6-8;7-5-3-1-2-4-6(5)8/h2-7H,9H2,1H3;1-4,7-8H |
| InChIKey | IYECDRFUGAIURG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|