About CID 68539443
CID 68539443 (PubChem CID 68539443) has the molecular formula C8H13N2O2S-
and a molecular weight of 201.27 g/mol.
Molecular Properties
| Compound Name | CID 68539443 |
| PubChem CID | 68539443 |
| Molecular Formula | C8H13N2O2S- |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | — |
| SMILES | CC(N)c1ccccc1.NS(=O)[O-] |
| InChI | InChI=1S/C8H11N.H3NO2S/c1-7(9)8-5-3-2-4-6-8;1-4(2)3/h2-7H,9H2,1H3;1H2,(H,2,3)/p-1 |
| InChIKey | ILOBVMWFNVBQRT-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 68539443 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68539443?
The IUPAC name of CID 68539443 (CID 68539443) is not available.
What is the SMILES notation for CID 68539443?
The canonical SMILES for CID 68539443 is CC(N)c1ccccc1.NS(=O)[O-].
What is the InChIKey of CID 68539443?
The InChIKey is ILOBVMWFNVBQRT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11N.H3NO2S/c1-7(9)8-5-3-2-4-6-8;1-4(2)3/h2-7H,9H2,1H3;1H2,(H,2,3)/p-1.
What are the key properties of CID 68539443?
CID 68539443 has a molecular weight of 201.27 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68539443 is sourced from PubChem (CID 68539443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).