About ethane;formamide;1-phenylethanamine
ethane;formamide;1-phenylethanamine (PubChem CID 154651145) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is ethane;formamide;1-phenylethanamine.
Molecular Properties
| Compound Name | ethane;formamide;1-phenylethanamine |
| PubChem CID | 154651145 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | ethane;formamide;1-phenylethanamine |
| SMILES | CC.CC(N)c1ccccc1.NC=O |
| InChI | InChI=1S/C8H11N.C2H6.CH3NO/c1-7(9)8-5-3-2-4-6-8;1-2;2-1-3/h2-7H,9H2,1H3;1-2H3;1H,(H2,2,3) |
| InChIKey | ZHQBRBFKUKFANW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formamide;1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formamide;1-phenylethanamine?
The IUPAC name of ethane;formamide;1-phenylethanamine (CID 154651145) is ethane;formamide;1-phenylethanamine.
What is the SMILES notation for ethane;formamide;1-phenylethanamine?
The canonical SMILES for ethane;formamide;1-phenylethanamine is CC.CC(N)c1ccccc1.NC=O.
What is the InChIKey of ethane;formamide;1-phenylethanamine?
The InChIKey is ZHQBRBFKUKFANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H6.CH3NO/c1-7(9)8-5-3-2-4-6-8;1-2;2-1-3/h2-7H,9H2,1H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;formamide;1-phenylethanamine?
ethane;formamide;1-phenylethanamine has a molecular weight of 196.29 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formamide;1-phenylethanamine is sourced from PubChem (CID 154651145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).