About 2-isocyanoacetic acid;1-phenylethanamine
2-isocyanoacetic acid;1-phenylethanamine (PubChem CID 88788030) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-isocyanoacetic acid;1-phenylethanamine.
Molecular Properties
| Compound Name | 2-isocyanoacetic acid;1-phenylethanamine |
| PubChem CID | 88788030 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-isocyanoacetic acid;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.[C-]#[N+]CC(=O)O |
| InChI | InChI=1S/C8H11N.C3H3NO2/c1-7(9)8-5-3-2-4-6-8;1-4-2-3(5)6/h2-7H,9H2,1H3;2H2,(H,5,6) |
| InChIKey | KBELODHJZUOPKC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanoacetic acid;1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanoacetic acid;1-phenylethanamine?
The IUPAC name of 2-isocyanoacetic acid;1-phenylethanamine (CID 88788030) is 2-isocyanoacetic acid;1-phenylethanamine.
What is the SMILES notation for 2-isocyanoacetic acid;1-phenylethanamine?
The canonical SMILES for 2-isocyanoacetic acid;1-phenylethanamine is CC(N)c1ccccc1.[C-]#[N+]CC(=O)O.
What is the InChIKey of 2-isocyanoacetic acid;1-phenylethanamine?
The InChIKey is KBELODHJZUOPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C3H3NO2/c1-7(9)8-5-3-2-4-6-8;1-4-2-3(5)6/h2-7H,9H2,1H3;2H2,(H,5,6).
What are the key properties of 2-isocyanoacetic acid;1-phenylethanamine?
2-isocyanoacetic acid;1-phenylethanamine has a molecular weight of 206.24 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanoacetic acid;1-phenylethanamine is sourced from PubChem (CID 88788030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).